C20H26FN3O5 — CID 91525067
(2R)-2-amino-2-[8-(2-fluoropyridine-4-carbonyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid (PubChem CID 91525067) has the molecular formula C20H26FN3O5 and a molecular weight of 407.44 g/mol. Its IUPAC name is (2R)-2-amino-2-[8-(2-fluoropyridine-4-carbonyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid.
| Compound Name | (2R)-2-amino-2-[8-(2-fluoropyridine-4-carbonyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 91525067 |
| Molecular Formula | C20H26FN3O5 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (2R)-2-amino-2-[8-(2-fluoropyridine-4-carbonyl)-8-azabicyclo[3.2.1]octan-3-yl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@](N)(C(=O)O)C1CC2CCC(C1)N2C(=O)c1ccnc(F)c1 |
| InChI | InChI=1S/C20H26FN3O5/c1-19(2,3)29-18(28)20(22,17(26)27)12-9-13-4-5-14(10-12)24(13)16(25)11-6-7-23-15(21)8-11/h6-8,12-14H,4-5,9-10,22H2,1-3H3,(H,26,27)/t12?,13?,14?,20-/m1/s1 |
| InChIKey | RSESRJDFZIQZJI-HKZYZGEHSA-N |
| XLogP | 1.73 |
| TPSA | 122.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|