About 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea
1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea (PubChem CID 91527132) has the molecular formula C12H12N4OS
and a molecular weight of 260.32 g/mol. Its IUPAC name is 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea.
Molecular Properties
| Compound Name | 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea |
| PubChem CID | 91527132 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea |
| SMILES | C=C=CNC(=S)NNc1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C12H12N4OS/c1-2-7-13-12(18)16-15-10-8-5-3-4-6-9(8)14-11(10)17/h3-7,14-15,17H,1H2,(H2,13,16,18) |
| InChIKey | VAHBEIHFSYMTEL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea?
The IUPAC name of 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea (CID 91527132) is 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea.
What is the SMILES notation for 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea?
The canonical SMILES for 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea is C=C=CNC(=S)NNc1c(O)[nH]c2ccccc12.
What is the InChIKey of 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea?
The InChIKey is VAHBEIHFSYMTEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4OS/c1-2-7-13-12(18)16-15-10-8-5-3-4-6-9(8)14-11(10)17/h3-7,14-15,17H,1H2,(H2,13,16,18).
What are the key properties of 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea?
1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea has a molecular weight of 260.32 g/mol, XLogP of 1.96, 3 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea is sourced from PubChem (CID 91527132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).