C12H12N4OS — CID 91527132
1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea (PubChem CID 91527132) has the molecular formula C12H12N4OS and a molecular weight of 260.32 g/mol. Its IUPAC name is 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea.
| Compound Name | 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea |
|---|---|
| PubChem CID | 91527132 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 1-[(2-hydroxy-1H-indol-3-yl)amino]-3-propa-1,2-dienylthiourea |
| SMILES | C=C=CNC(=S)NNc1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C12H12N4OS/c1-2-7-13-12(18)16-15-10-8-5-3-4-6-9(8)14-11(10)17/h3-7,14-15,17H,1H2,(H2,13,16,18) |
| InChIKey | VAHBEIHFSYMTEL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|