C26H25NO4 — CID 91527302
(5R)-3-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]-5-(2-phenylethyl)pyrrolidine-2,4-dione (PubChem CID 91527302) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is (5R)-3-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]-5-(2-phenylethyl)pyrrolidine-2,4-dione.
| Compound Name | (5R)-3-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]-5-(2-phenylethyl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 91527302 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (5R)-3-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]-5-(2-phenylethyl)pyrrolidine-2,4-dione |
| SMILES | COc1ccc2cc([C@H](C)C(=O)C3C(=O)N[C@H](CCc4ccccc4)C3=O)ccc2c1 |
| InChI | InChI=1S/C26H25NO4/c1-16(18-9-10-20-15-21(31-2)12-11-19(20)14-18)24(28)23-25(29)22(27-26(23)30)13-8-17-6-4-3-5-7-17/h3-7,9-12,14-16,22-23H,8,13H2,1-2H3,(H,27,30)/t16-,22+,23?/m0/s1 |
| InChIKey | SHUFMOMEUOJFFB-JGTULBKXSA-N |
| XLogP | 3.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|