C24H50 — CID 91527902
4-butan-2-yl-5-tert-butyl-5,7-diethyl-2-methylundecane (PubChem CID 91527902) has the molecular formula C24H50 and a molecular weight of 338.66 g/mol. Its IUPAC name is 4-butan-2-yl-5-tert-butyl-5,7-diethyl-2-methylundecane.
| Compound Name | 4-butan-2-yl-5-tert-butyl-5,7-diethyl-2-methylundecane |
|---|---|
| PubChem CID | 91527902 |
| Molecular Formula | C24H50 |
| Molecular Weight | 338.66 g/mol |
| Exact Mass | 338.39 |
| IUPAC Name | 4-butan-2-yl-5-tert-butyl-5,7-diethyl-2-methylundecane |
| SMILES | CCCCC(CC)CC(CC)(C(CC(C)C)C(C)CC)C(C)(C)C |
| InChI | InChI=1S/C24H50/c1-11-15-16-21(13-3)18-24(14-4,23(8,9)10)22(17-19(5)6)20(7)12-2/h19-22H,11-18H2,1-10H3 |
| InChIKey | TYGSPBMJTAQIGL-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.66 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |