About 1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane
1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane (PubChem CID 91530216) has the molecular formula C22H34O4
and a molecular weight of 362.51 g/mol. Its IUPAC name is 1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane.
Molecular Properties
| Compound Name | 1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane |
| PubChem CID | 91530216 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane |
| SMILES | CCC.CCC.CCCOO.O=C(c1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C13H10O2.C3H8O2.2C3H8/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10;1-2-3-5-4;2*1-3-2/h1-9,14H;4H,2-3H2,1H3;2*3H2,1-2H3 |
| InChIKey | GJCQLIBJYPZTAN-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane?
The IUPAC name of 1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane (CID 91530216) is 1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane.
What is the SMILES notation for 1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane?
The canonical SMILES for 1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane is CCC.CCC.CCCOO.O=C(c1ccccc1)c1ccccc1O.
What is the InChIKey of 1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane?
The InChIKey is GJCQLIBJYPZTAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2.C3H8O2.2C3H8/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10;1-2-3-5-4;2*1-3-2/h1-9,14H;4H,2-3H2,1H3;2*3H2,1-2H3.
What are the key properties of 1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane?
1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane has a molecular weight of 362.51 g/mol, XLogP of 6.34, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroperoxypropane;(2-hydroxyphenyl)-phenylmethanone;propane is sourced from PubChem (CID 91530216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).