C16H22F6O3 — CID 91532326
2-(2-bicyclo[2.2.1]heptanylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol;methyl 2-methylprop-2-enoate (PubChem CID 91532326) has the molecular formula C16H22F6O3 and a molecular weight of 376.34 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol;methyl 2-methylprop-2-enoate.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91532326 |
| Molecular Formula | C16H22F6O3 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.OC(CC1CC2CCC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H14F6O.C5H8O2/c12-10(13,14)9(18,11(15,16)17)5-8-4-6-1-2-7(8)3-6;1-4(2)5(6)7-3/h6-8,18H,1-5H2;1H2,2-3H3 |
| InChIKey | AFKAAEYMYMPIBC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|