C25H30N4O6S — CID 91532474
5-[1-[2-[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]ethyl]pyrazol-3-yl]-N-(oxan-2-yloxy)thiophene-2-carboxamide (PubChem CID 91532474) has the molecular formula C25H30N4O6S and a molecular weight of 514.60 g/mol. Its IUPAC name is 5-[1-[2-[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]ethyl]pyrazol-3-yl]-N-(oxan-2-yloxy)thiophene-2-carboxamide.
| Compound Name | 5-[1-[2-[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]ethyl]pyrazol-3-yl]-N-(oxan-2-yloxy)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91532474 |
| Molecular Formula | C25H30N4O6S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 5-[1-[2-[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]ethyl]pyrazol-3-yl]-N-(oxan-2-yloxy)thiophene-2-carboxamide |
| SMILES | O=C(NOC1CCCCO1)c1ccc(-c2ccn(CCN(CCO)Cc3ccc4c(c3)OCO4)n2)s1 |
| InChI | InChI=1S/C25H30N4O6S/c30-13-12-28(16-18-4-5-20-21(15-18)34-17-33-20)10-11-29-9-8-19(26-29)22-6-7-23(36-22)25(31)27-35-24-3-1-2-14-32-24/h4-9,15,24,30H,1-3,10-14,16-17H2,(H,27,31) |
| InChIKey | OWJUMLGVUGRPFK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|