C24H27ClN4O3S — CID 91532745
[8-(2-phenylethylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(4-chlorophenyl)methyl]carbamate (PubChem CID 91532745) has the molecular formula C24H27ClN4O3S and a molecular weight of 487.03 g/mol. Its IUPAC name is [8-(2-phenylethylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(4-chlorophenyl)methyl]carbamate.
| Compound Name | [8-(2-phenylethylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(4-chlorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 91532745 |
| Molecular Formula | C24H27ClN4O3S |
| Molecular Weight | 487.03 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | [8-(2-phenylethylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl] N-[(4-chlorophenyl)methyl]carbamate |
| SMILES | O=C(NCc1ccc(Cl)cc1)OC1=CC2(CCN(C(=S)NCCc3ccccc3)CC2)ON1 |
| InChI | InChI=1S/C24H27ClN4O3S/c25-20-8-6-19(7-9-20)17-27-23(30)31-21-16-24(32-28-21)11-14-29(15-12-24)22(33)26-13-10-18-4-2-1-3-5-18/h1-9,16,28H,10-15,17H2,(H,26,33)(H,27,30) |
| InChIKey | NZPSKXXXGRTADV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.03 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|