C8H17N3 — CID 91535523
1-butan-2-yl-3,4-dimethyl-2H-triazole (PubChem CID 91535523) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is 1-butan-2-yl-3,4-dimethyl-2H-triazole.
| Compound Name | 1-butan-2-yl-3,4-dimethyl-2H-triazole |
|---|---|
| PubChem CID | 91535523 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 1-butan-2-yl-3,4-dimethyl-2H-triazole |
| SMILES | CCC(C)N1C=C(C)N(C)N1 |
| InChI | InChI=1S/C8H17N3/c1-5-7(2)11-6-8(3)10(4)9-11/h6-7,9H,5H2,1-4H3 |
| InChIKey | MUVKHJAKXHDKOY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |