C28H40N2O3 — CID 91537650
1-[3,6-bis(diethylamino)heptoxy]xanthen-9-one (PubChem CID 91537650) has the molecular formula C28H40N2O3 and a molecular weight of 452.64 g/mol. Its IUPAC name is 1-[3,6-bis(diethylamino)heptoxy]xanthen-9-one.
| Compound Name | 1-[3,6-bis(diethylamino)heptoxy]xanthen-9-one |
|---|---|
| PubChem CID | 91537650 |
| Molecular Formula | C28H40N2O3 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | 1-[3,6-bis(diethylamino)heptoxy]xanthen-9-one |
| SMILES | CCN(CC)C(C)CCC(CCOc1cccc2oc3ccccc3c(=O)c12)N(CC)CC |
| InChI | InChI=1S/C28H40N2O3/c1-6-29(7-2)21(5)17-18-22(30(8-3)9-4)19-20-32-25-15-12-16-26-27(25)28(31)23-13-10-11-14-24(23)33-26/h10-16,21-22H,6-9,17-20H2,1-5H3 |
| InChIKey | TUEFGKHRVHXLQI-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|