C26H32BrIN4O2 — CID 91541843
1-(2-bromoethyl)-1-[2-iodoethyl(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)amino]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea (PubChem CID 91541843) has the molecular formula C26H32BrIN4O2 and a molecular weight of 639.38 g/mol. Its IUPAC name is 1-(2-bromoethyl)-1-[2-iodoethyl(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)amino]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea.
| Compound Name | 1-(2-bromoethyl)-1-[2-iodoethyl(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)amino]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 91541843 |
| Molecular Formula | C26H32BrIN4O2 |
| Molecular Weight | 639.38 g/mol |
| Exact Mass | 638.08 |
| IUPAC Name | 1-(2-bromoethyl)-1-[2-iodoethyl(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)amino]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea |
| SMILES | O=C(NC1CCCc2ccccc21)N(CCBr)N(CCI)C(=O)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C26H32BrIN4O2/c27-15-17-31(25(33)29-23-13-5-9-19-7-1-3-11-21(19)23)32(18-16-28)26(34)30-24-14-6-10-20-8-2-4-12-22(20)24/h1-4,7-8,11-12,23-24H,5-6,9-10,13-18H2,(H,29,33)(H,30,34) |
| InChIKey | MDLQAESAWMNLBR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.38 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|