C11H16N4O2 — CID 91542244
4-(4,6-dimethylpyrimidin-2-yl)piperazine-1-carboxylic acid (PubChem CID 91542244) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-(4,6-dimethylpyrimidin-2-yl)piperazine-1-carboxylic acid.
| Compound Name | 4-(4,6-dimethylpyrimidin-2-yl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 91542244 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 4-(4,6-dimethylpyrimidin-2-yl)piperazine-1-carboxylic acid |
| SMILES | Cc1cc(C)nc(N2CCN(C(=O)O)CC2)n1 |
| InChI | InChI=1S/C11H16N4O2/c1-8-7-9(2)13-10(12-8)14-3-5-15(6-4-14)11(16)17/h7H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | PXKLZSGQXYRGHI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |