C15H22N2O — CID 91542652
4-(dimethylamino)-N-(5-methylideneocta-1,3,6-trien-3-yl)but-2-enamide (PubChem CID 91542652) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-(dimethylamino)-N-(5-methylideneocta-1,3,6-trien-3-yl)but-2-enamide.
| Compound Name | 4-(dimethylamino)-N-(5-methylideneocta-1,3,6-trien-3-yl)but-2-enamide |
|---|---|
| PubChem CID | 91542652 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 4-(dimethylamino)-N-(5-methylideneocta-1,3,6-trien-3-yl)but-2-enamide |
| SMILES | C=CC(=CC(=C)C=CC)NC(=O)C=CCN(C)C |
| InChI | InChI=1S/C15H22N2O/c1-6-9-13(3)12-14(7-2)16-15(18)10-8-11-17(4)5/h6-10,12H,2-3,11H2,1,4-5H3,(H,16,18) |
| InChIKey | URPHEQKNEPUTGA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|