C14H19NO2 — CID 91543676
2-[1-(4-aminophenyl)cyclobutyl]butanoic acid (PubChem CID 91543676) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-[1-(4-aminophenyl)cyclobutyl]butanoic acid.
| Compound Name | 2-[1-(4-aminophenyl)cyclobutyl]butanoic acid |
|---|---|
| PubChem CID | 91543676 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-[1-(4-aminophenyl)cyclobutyl]butanoic acid |
| SMILES | CCC(C(=O)O)C1(c2ccc(N)cc2)CCC1 |
| InChI | InChI=1S/C14H19NO2/c1-2-12(13(16)17)14(8-3-9-14)10-4-6-11(15)7-5-10/h4-7,12H,2-3,8-9,15H2,1H3,(H,16,17) |
| InChIKey | LQGXRSXYZNFDHN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|