C20H22O3 — CID 176908723
(2R)-2-(7-methoxy-1-phenyl-2,3-dihydroinden-1-yl)butanoic acid (PubChem CID 176908723) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is (2R)-2-(7-methoxy-1-phenyl-2,3-dihydroinden-1-yl)butanoic acid.
| Compound Name | (2R)-2-(7-methoxy-1-phenyl-2,3-dihydroinden-1-yl)butanoic acid |
|---|---|
| PubChem CID | 176908723 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (2R)-2-(7-methoxy-1-phenyl-2,3-dihydroinden-1-yl)butanoic acid |
| SMILES | CC[C@H](C(=O)O)C1(c2ccccc2)CCc2cccc(OC)c21 |
| InChI | InChI=1S/C20H22O3/c1-3-16(19(21)22)20(15-9-5-4-6-10-15)13-12-14-8-7-11-17(23-2)18(14)20/h4-11,16H,3,12-13H2,1-2H3,(H,21,22)/t16-,20?/m1/s1 |
| InChIKey | ZNBALYQBIGEDPJ-QRIPLOBPSA-N |
| XLogP | 4.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |