About hydroperoxyethane;4-(1-methylcyclobutyl)aniline
hydroperoxyethane;4-(1-methylcyclobutyl)aniline (PubChem CID 142556630) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is hydroperoxyethane;4-(1-methylcyclobutyl)aniline.
Molecular Properties
| Compound Name | hydroperoxyethane;4-(1-methylcyclobutyl)aniline |
| PubChem CID | 142556630 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | hydroperoxyethane;4-(1-methylcyclobutyl)aniline |
| SMILES | CC1(c2ccc(N)cc2)CCC1.CCOO |
| InChI | InChI=1S/C11H15N.C2H6O2/c1-11(7-2-8-11)9-3-5-10(12)6-4-9;1-2-4-3/h3-6H,2,7-8,12H2,1H3;3H,2H2,1H3 |
| InChIKey | CEXWLTZOCOXKMO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydroperoxyethane;4-(1-methylcyclobutyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroperoxyethane;4-(1-methylcyclobutyl)aniline?
The IUPAC name of hydroperoxyethane;4-(1-methylcyclobutyl)aniline (CID 142556630) is hydroperoxyethane;4-(1-methylcyclobutyl)aniline.
What is the SMILES notation for hydroperoxyethane;4-(1-methylcyclobutyl)aniline?
The canonical SMILES for hydroperoxyethane;4-(1-methylcyclobutyl)aniline is CC1(c2ccc(N)cc2)CCC1.CCOO.
What is the InChIKey of hydroperoxyethane;4-(1-methylcyclobutyl)aniline?
The InChIKey is CEXWLTZOCOXKMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C2H6O2/c1-11(7-2-8-11)9-3-5-10(12)6-4-9;1-2-4-3/h3-6H,2,7-8,12H2,1H3;3H,2H2,1H3.
What are the key properties of hydroperoxyethane;4-(1-methylcyclobutyl)aniline?
hydroperoxyethane;4-(1-methylcyclobutyl)aniline has a molecular weight of 223.32 g/mol, XLogP of 3.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroperoxyethane;4-(1-methylcyclobutyl)aniline is sourced from PubChem (CID 142556630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).