C11H16O2 — CID 91547732
3-(4-ethoxycyclohexa-2,4-dien-1-yl)propanal (PubChem CID 91547732) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-(4-ethoxycyclohexa-2,4-dien-1-yl)propanal.
| Compound Name | 3-(4-ethoxycyclohexa-2,4-dien-1-yl)propanal |
|---|---|
| PubChem CID | 91547732 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 3-(4-ethoxycyclohexa-2,4-dien-1-yl)propanal |
| SMILES | CCOC1=CCC(CCC=O)C=C1 |
| InChI | InChI=1S/C11H16O2/c1-2-13-11-7-5-10(6-8-11)4-3-9-12/h5,7-10H,2-4,6H2,1H3 |
| InChIKey | ITFPSSXKMHQDOI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|