C21H20Cl2N2O2 — CID 91548233
[2-(2,5-dichlorophenoxy)-3-pyridinyl]-(N,2,6-trimethylanilino)methanol (PubChem CID 91548233) has the molecular formula C21H20Cl2N2O2 and a molecular weight of 403.31 g/mol. Its IUPAC name is [2-(2,5-dichlorophenoxy)-3-pyridinyl]-(N,2,6-trimethylanilino)methanol.
| Compound Name | [2-(2,5-dichlorophenoxy)-3-pyridinyl]-(N,2,6-trimethylanilino)methanol |
|---|---|
| PubChem CID | 91548233 |
| Molecular Formula | C21H20Cl2N2O2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | [2-(2,5-dichlorophenoxy)-3-pyridinyl]-(N,2,6-trimethylanilino)methanol |
| SMILES | Cc1cccc(C)c1N(C)C(O)c1cccnc1Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H20Cl2N2O2/c1-13-6-4-7-14(2)19(13)25(3)21(26)16-8-5-11-24-20(16)27-18-12-15(22)9-10-17(18)23/h4-12,21,26H,1-3H3 |
| InChIKey | UJMYSEFZZCZIMH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|