C20H28N2O2 — CID 91549117
1-[(2R)-1-[(2S)-5-methylpyrrolidine-2-carbonyl]pyrrolidin-2-yl]-4-phenylbutan-1-one (PubChem CID 91549117) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-[(2R)-1-[(2S)-5-methylpyrrolidine-2-carbonyl]pyrrolidin-2-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[(2R)-1-[(2S)-5-methylpyrrolidine-2-carbonyl]pyrrolidin-2-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 91549117 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1-[(2R)-1-[(2S)-5-methylpyrrolidine-2-carbonyl]pyrrolidin-2-yl]-4-phenylbutan-1-one |
| SMILES | CC1CC[C@@H](C(=O)N2CCC[C@@H]2C(=O)CCCc2ccccc2)N1 |
| InChI | InChI=1S/C20H28N2O2/c1-15-12-13-17(21-15)20(24)22-14-6-10-18(22)19(23)11-5-9-16-7-3-2-4-8-16/h2-4,7-8,15,17-18,21H,5-6,9-14H2,1H3/t15?,17-,18+/m0/s1 |
| InChIKey | WASBYFJKOYAXOP-XSRYCBBQSA-N |
| XLogP | 2.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |