C18H23NO4 — CID 11120688
methyl 2-oxo-2-[(2S)-2-(5-phenylpentanoyl)pyrrolidin-1-yl]acetate (PubChem CID 11120688) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is methyl 2-oxo-2-[(2S)-2-(5-phenylpentanoyl)pyrrolidin-1-yl]acetate.
| Compound Name | methyl 2-oxo-2-[(2S)-2-(5-phenylpentanoyl)pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 11120688 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | methyl 2-oxo-2-[(2S)-2-(5-phenylpentanoyl)pyrrolidin-1-yl]acetate |
| SMILES | COC(=O)C(=O)N1CCC[C@H]1C(=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C18H23NO4/c1-23-18(22)17(21)19-13-7-11-15(19)16(20)12-6-5-10-14-8-3-2-4-9-14/h2-4,8-9,15H,5-7,10-13H2,1H3/t15-/m0/s1 |
| InChIKey | BLMGVSBGZHUHMV-HNNXBMFYSA-N |
| XLogP | 2.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|