C12H11F3N2O3 — CID 91552652
3-[[4-(trifluoromethoxy)phenyl]diazenyl]pentane-2,4-dione (PubChem CID 91552652) has the molecular formula C12H11F3N2O3 and a molecular weight of 288.23 g/mol. Its IUPAC name is 3-[[4-(trifluoromethoxy)phenyl]diazenyl]pentane-2,4-dione.
| Compound Name | 3-[[4-(trifluoromethoxy)phenyl]diazenyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 91552652 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 3-[[4-(trifluoromethoxy)phenyl]diazenyl]pentane-2,4-dione |
| SMILES | CC(=O)C(/N=N/c1ccc(OC(F)(F)F)cc1)C(C)=O |
| InChI | InChI=1S/C12H11F3N2O3/c1-7(18)11(8(2)19)17-16-9-3-5-10(6-4-9)20-12(13,14)15/h3-6,11H,1-2H3/b17-16+ |
| InChIKey | LUFWFPSGUGUSOB-WUKNDPDISA-N |
| XLogP | 3.22 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|