C27H43NO4 — CID 91554175
(1-carbamoylcyclopropyl) 8-[3-(2-methyloctan-2-yl)phenoxy]octanoate (PubChem CID 91554175) has the molecular formula C27H43NO4 and a molecular weight of 445.64 g/mol. Its IUPAC name is (1-carbamoylcyclopropyl) 8-[3-(2-methyloctan-2-yl)phenoxy]octanoate.
| Compound Name | (1-carbamoylcyclopropyl) 8-[3-(2-methyloctan-2-yl)phenoxy]octanoate |
|---|---|
| PubChem CID | 91554175 |
| Molecular Formula | C27H43NO4 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | (1-carbamoylcyclopropyl) 8-[3-(2-methyloctan-2-yl)phenoxy]octanoate |
| SMILES | CCCCCCC(C)(C)c1cccc(OCCCCCCCC(=O)OC2(C(N)=O)CC2)c1 |
| InChI | InChI=1S/C27H43NO4/c1-4-5-6-11-17-26(2,3)22-14-13-15-23(21-22)31-20-12-9-7-8-10-16-24(29)32-27(18-19-27)25(28)30/h13-15,21H,4-12,16-20H2,1-3H3,(H2,28,30) |
| InChIKey | FZCQYFWCLZJXBU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|