C8H14N2O3 — CID 91557440
1-[2-(2-hydroxyethylamino)ethyl]pyrrole-2,5-diol (PubChem CID 91557440) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethylamino)ethyl]pyrrole-2,5-diol.
| Compound Name | 1-[2-(2-hydroxyethylamino)ethyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91557440 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-[2-(2-hydroxyethylamino)ethyl]pyrrole-2,5-diol |
| SMILES | OCCNCCn1c(O)ccc1O |
| InChI | InChI=1S/C8H14N2O3/c11-6-4-9-3-5-10-7(12)1-2-8(10)13/h1-2,9,11-13H,3-6H2 |
| InChIKey | FKJODKPTPSOPAY-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|