C17H18O4 — CID 91558064
(2S,3S)-3,5-bis(4-hydroxyphenyl)pent-4-ene-1,2-diol (PubChem CID 91558064) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2S,3S)-3,5-bis(4-hydroxyphenyl)pent-4-ene-1,2-diol.
| Compound Name | (2S,3S)-3,5-bis(4-hydroxyphenyl)pent-4-ene-1,2-diol |
|---|---|
| PubChem CID | 91558064 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (2S,3S)-3,5-bis(4-hydroxyphenyl)pent-4-ene-1,2-diol |
| SMILES | OC[C@@H](O)[C@@H](C=Cc1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H18O4/c18-11-17(21)16(13-4-8-15(20)9-5-13)10-3-12-1-6-14(19)7-2-12/h1-10,16-21H,11H2/t16-,17+/m0/s1 |
| InChIKey | DVUXXXYVVWRAIA-DLBZAZTESA-N |
| XLogP | 2.25 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |