C29H38N4O3 — CID 91558624
8-benzyl-3-ethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one;1-benzyl-4-hydroxypiperidine-4-carbonitrile (PubChem CID 91558624) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is 8-benzyl-3-ethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one;1-benzyl-4-hydroxypiperidine-4-carbonitrile.
| Compound Name | 8-benzyl-3-ethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one;1-benzyl-4-hydroxypiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 91558624 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 8-benzyl-3-ethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one;1-benzyl-4-hydroxypiperidine-4-carbonitrile |
| SMILES | CCN1CC2(CCN(Cc3ccccc3)CC2)OC1=O.N#CC1(O)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C16H22N2O2.C13H16N2O/c1-2-18-13-16(20-15(18)19)8-10-17(11-9-16)12-14-6-4-3-5-7-14;14-11-13(16)6-8-15(9-7-13)10-12-4-2-1-3-5-12/h3-7H,2,8-13H2,1H3;1-5,16H,6-10H2 |
| InChIKey | RZQNMPCBWCDEIW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|