C31H31N4O4P — CID 91558660
2-[4-(2-diethoxyphosphorylethenyl)-2,6-dimethylphenyl]-N-quinolin-2-yl-3H-benzimidazole-5-carboxamide (PubChem CID 91558660) has the molecular formula C31H31N4O4P and a molecular weight of 554.59 g/mol. Its IUPAC name is 2-[4-(2-diethoxyphosphorylethenyl)-2,6-dimethylphenyl]-N-quinolin-2-yl-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-(2-diethoxyphosphorylethenyl)-2,6-dimethylphenyl]-N-quinolin-2-yl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 91558660 |
| Molecular Formula | C31H31N4O4P |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 2-[4-(2-diethoxyphosphorylethenyl)-2,6-dimethylphenyl]-N-quinolin-2-yl-3H-benzimidazole-5-carboxamide |
| SMILES | CCOP(=O)(C=Cc1cc(C)c(-c2nc3ccc(C(=O)Nc4ccc5ccccc5n4)cc3[nH]2)c(C)c1)OCC |
| InChI | InChI=1S/C31H31N4O4P/c1-5-38-40(37,39-6-2)16-15-22-17-20(3)29(21(4)18-22)30-33-26-13-11-24(19-27(26)34-30)31(36)35-28-14-12-23-9-7-8-10-25(23)32-28/h7-19H,5-6H2,1-4H3,(H,33,34)(H,32,35,36) |
| InChIKey | HEIFOUCBNFWFKY-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|