C20H28FN4O3+ — CID 91558676
tert-butyl N-[1-[2-(7-fluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-1-ium-1-yl]carbamate (PubChem CID 91558676) has the molecular formula C20H28FN4O3+ and a molecular weight of 391.47 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(7-fluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-1-ium-1-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(7-fluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-1-ium-1-yl]carbamate |
|---|---|
| PubChem CID | 91558676 |
| Molecular Formula | C20H28FN4O3+ |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | tert-butyl N-[1-[2-(7-fluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-1-ium-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[N+]1(CCn2c(=O)cnc3ccc(F)cc32)CCCCC1 |
| InChI | InChI=1S/C20H27FN4O3/c1-20(2,3)28-19(27)23-25(10-5-4-6-11-25)12-9-24-17-13-15(21)7-8-16(17)22-14-18(24)26/h7-8,13-14H,4-6,9-12H2,1-3H3/p+1 |
| InChIKey | HLDYARPXZVUMPF-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|