C29H35BrN4O2 — CID 91558775
[4-[4-[(4-bromophenyl)-(ethoxyamino)methylidene]piperidin-1-yl]-4-methylpiperidin-1-yl]-(1H-indol-6-yl)methanone (PubChem CID 91558775) has the molecular formula C29H35BrN4O2 and a molecular weight of 551.53 g/mol. Its IUPAC name is [4-[4-[(4-bromophenyl)-(ethoxyamino)methylidene]piperidin-1-yl]-4-methylpiperidin-1-yl]-(1H-indol-6-yl)methanone.
| Compound Name | [4-[4-[(4-bromophenyl)-(ethoxyamino)methylidene]piperidin-1-yl]-4-methylpiperidin-1-yl]-(1H-indol-6-yl)methanone |
|---|---|
| PubChem CID | 91558775 |
| Molecular Formula | C29H35BrN4O2 |
| Molecular Weight | 551.53 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | [4-[4-[(4-bromophenyl)-(ethoxyamino)methylidene]piperidin-1-yl]-4-methylpiperidin-1-yl]-(1H-indol-6-yl)methanone |
| SMILES | CCONC(=C1CCN(C2(C)CCN(C(=O)c3ccc4cc[nH]c4c3)CC2)CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C29H35BrN4O2/c1-3-36-32-27(22-6-8-25(30)9-7-22)23-11-16-34(17-12-23)29(2)13-18-33(19-14-29)28(35)24-5-4-21-10-15-31-26(21)20-24/h4-10,15,20,31-32H,3,11-14,16-19H2,1-2H3 |
| InChIKey | FOQFOQJENQOTIF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|