C31H39BrN4O2 — CID 91034014
[4-[4-[(4-bromophenyl)-(ethoxyamino)methylidene]piperidin-1-yl]-4-methylpiperidin-1-yl]-(1-ethylindol-6-yl)methanone (PubChem CID 91034014) has the molecular formula C31H39BrN4O2 and a molecular weight of 579.58 g/mol. Its IUPAC name is [4-[4-[(4-bromophenyl)-(ethoxyamino)methylidene]piperidin-1-yl]-4-methylpiperidin-1-yl]-(1-ethylindol-6-yl)methanone.
| Compound Name | [4-[4-[(4-bromophenyl)-(ethoxyamino)methylidene]piperidin-1-yl]-4-methylpiperidin-1-yl]-(1-ethylindol-6-yl)methanone |
|---|---|
| PubChem CID | 91034014 |
| Molecular Formula | C31H39BrN4O2 |
| Molecular Weight | 579.58 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | [4-[4-[(4-bromophenyl)-(ethoxyamino)methylidene]piperidin-1-yl]-4-methylpiperidin-1-yl]-(1-ethylindol-6-yl)methanone |
| SMILES | CCONC(=C1CCN(C2(C)CCN(C(=O)c3ccc4ccn(CC)c4c3)CC2)CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H39BrN4O2/c1-4-34-17-12-23-6-7-26(22-28(23)34)30(37)35-20-15-31(3,16-21-35)36-18-13-25(14-19-36)29(33-38-5-2)24-8-10-27(32)11-9-24/h6-12,17,22,33H,4-5,13-16,18-21H2,1-3H3 |
| InChIKey | KHVULXPZXUDRJS-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.58 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|