C20H14ClF4NO3S — CID 91559859
5-[(1R)-5-[2-chloro-4-(1,2,2,2-tetrafluoroethyl)phenoxy]-2,3-dihydro-1H-inden-1-yl]-4-hydroxy-3H-1,3-thiazol-2-one (PubChem CID 91559859) has the molecular formula C20H14ClF4NO3S and a molecular weight of 459.85 g/mol. Its IUPAC name is 5-[(1R)-5-[2-chloro-4-(1,2,2,2-tetrafluoroethyl)phenoxy]-2,3-dihydro-1H-inden-1-yl]-4-hydroxy-3H-1,3-thiazol-2-one.
| Compound Name | 5-[(1R)-5-[2-chloro-4-(1,2,2,2-tetrafluoroethyl)phenoxy]-2,3-dihydro-1H-inden-1-yl]-4-hydroxy-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 91559859 |
| Molecular Formula | C20H14ClF4NO3S |
| Molecular Weight | 459.85 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | 5-[(1R)-5-[2-chloro-4-(1,2,2,2-tetrafluoroethyl)phenoxy]-2,3-dihydro-1H-inden-1-yl]-4-hydroxy-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(O)c([C@@H]2CCc3cc(Oc4ccc(C(F)C(F)(F)F)cc4Cl)ccc32)s1 |
| InChI | InChI=1S/C20H14ClF4NO3S/c21-14-8-10(17(22)20(23,24)25)2-6-15(14)29-11-3-5-12-9(7-11)1-4-13(12)16-18(27)26-19(28)30-16/h2-3,5-8,13,17,27H,1,4H2,(H,26,28)/t13-,17?/m1/s1 |
| InChIKey | SZDCVQVRHXRMHE-FWJOYPJLSA-N |
| XLogP | 6.24 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.85 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |