C15H27N3 — CID 91561321
N-[(2Z)-hepta-2,5-dien-2-yl]-N'-piperidin-3-ylpropanimidamide (PubChem CID 91561321) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N-[(2Z)-hepta-2,5-dien-2-yl]-N'-piperidin-3-ylpropanimidamide.
| Compound Name | N-[(2Z)-hepta-2,5-dien-2-yl]-N'-piperidin-3-ylpropanimidamide |
|---|---|
| PubChem CID | 91561321 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N-[(2Z)-hepta-2,5-dien-2-yl]-N'-piperidin-3-ylpropanimidamide |
| SMILES | CC=CC/C=C(/C)N/C(CC)=N/C1CCCNC1 |
| InChI | InChI=1S/C15H27N3/c1-4-6-7-9-13(3)17-15(5-2)18-14-10-8-11-16-12-14/h4,6,9,14,16H,5,7-8,10-12H2,1-3H3,(H,17,18)/b6-4?,13-9- |
| InChIKey | ZPEBSMHYPGMXQC-PPUCDNHWSA-N |
| XLogP | 3.01 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|