C28H48N4S — CID 145324173
2-butyl-N'-piperidin-3-yl-1,3-thiazole-4-carboximidamide;ethane;(2Z,4Z,5Z,7E)-4-ethylidene-5-methyldeca-2,5,7-triene (PubChem CID 145324173) has the molecular formula C28H48N4S and a molecular weight of 472.79 g/mol. Its IUPAC name is 2-butyl-N'-piperidin-3-yl-1,3-thiazole-4-carboximidamide;ethane;(2Z,4Z,5Z,7E)-4-ethylidene-5-methyldeca-2,5,7-triene.
| Compound Name | 2-butyl-N'-piperidin-3-yl-1,3-thiazole-4-carboximidamide;ethane;(2Z,4Z,5Z,7E)-4-ethylidene-5-methyldeca-2,5,7-triene |
|---|---|
| PubChem CID | 145324173 |
| Molecular Formula | C28H48N4S |
| Molecular Weight | 472.79 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | 2-butyl-N'-piperidin-3-yl-1,3-thiazole-4-carboximidamide;ethane;(2Z,4Z,5Z,7E)-4-ethylidene-5-methyldeca-2,5,7-triene |
| SMILES | C/C=C\C(=C\C)\C(C)=C/C=C/CC.CC.CCCCc1nc(/C(N)=N/C2CCCNC2)cs1 |
| InChI | InChI=1S/C13H22N4S.C13H20.C2H6/c1-2-3-6-12-17-11(9-18-12)13(14)16-10-5-4-7-15-8-10;1-5-8-9-11-12(4)13(7-3)10-6-2;1-2/h9-10,15H,2-8H2,1H3,(H2,14,16);6-11H,5H2,1-4H3;1-2H3/b;9-8+,10-6-,12-11-,13-7-; |
| InChIKey | ZIDOYYULIXIDGC-NDWUHCQUSA-N |
| XLogP | 7.39 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.79 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|