C18H18BrF2N3O3S — CID 91562933
4-[4-bromo-2-(1,1-difluoroprop-2-enyl)phenyl]sulfonyl-N-(1-cyanocyclopropyl)pyrrolidine-2-carboxamide (PubChem CID 91562933) has the molecular formula C18H18BrF2N3O3S and a molecular weight of 474.33 g/mol. Its IUPAC name is 4-[4-bromo-2-(1,1-difluoroprop-2-enyl)phenyl]sulfonyl-N-(1-cyanocyclopropyl)pyrrolidine-2-carboxamide.
| Compound Name | 4-[4-bromo-2-(1,1-difluoroprop-2-enyl)phenyl]sulfonyl-N-(1-cyanocyclopropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91562933 |
| Molecular Formula | C18H18BrF2N3O3S |
| Molecular Weight | 474.33 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 4-[4-bromo-2-(1,1-difluoroprop-2-enyl)phenyl]sulfonyl-N-(1-cyanocyclopropyl)pyrrolidine-2-carboxamide |
| SMILES | C=CC(F)(F)c1cc(Br)ccc1S(=O)(=O)C1CNC(C(=O)NC2(C#N)CC2)C1 |
| InChI | InChI=1S/C18H18BrF2N3O3S/c1-2-18(20,21)13-7-11(19)3-4-15(13)28(26,27)12-8-14(23-9-12)16(25)24-17(10-22)5-6-17/h2-4,7,12,14,23H,1,5-6,8-9H2,(H,24,25) |
| InChIKey | GCKQLNYNQLDMNI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|