C13H17ClFNO6S2 — CID 91565032
3-[bis(propylsulfonyl)amino]-2-chloro-6-fluorobenzoic acid (PubChem CID 91565032) has the molecular formula C13H17ClFNO6S2 and a molecular weight of 401.87 g/mol. Its IUPAC name is 3-[bis(propylsulfonyl)amino]-2-chloro-6-fluorobenzoic acid.
| Compound Name | 3-[bis(propylsulfonyl)amino]-2-chloro-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 91565032 |
| Molecular Formula | C13H17ClFNO6S2 |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 3-[bis(propylsulfonyl)amino]-2-chloro-6-fluorobenzoic acid |
| SMILES | CCCS(=O)(=O)N(c1ccc(F)c(C(=O)O)c1Cl)S(=O)(=O)CCC |
| InChI | InChI=1S/C13H17ClFNO6S2/c1-3-7-23(19,20)16(24(21,22)8-4-2)10-6-5-9(15)11(12(10)14)13(17)18/h5-6H,3-4,7-8H2,1-2H3,(H,17,18) |
| InChIKey | QIDKYJMZNYIXGZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |