C15H21F2NO6S2 — CID 123294885
3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid (PubChem CID 123294885) has the molecular formula C15H21F2NO6S2 and a molecular weight of 413.46 g/mol. Its IUPAC name is 3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid.
| Compound Name | 3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid |
|---|---|
| PubChem CID | 123294885 |
| Molecular Formula | C15H21F2NO6S2 |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid |
| SMILES | CCCCS(=O)(=O)N(c1ccc(F)c(C(=O)O)c1F)S(=O)(=O)CCCC |
| InChI | InChI=1S/C15H21F2NO6S2/c1-3-5-9-25(21,22)18(26(23,24)10-6-4-2)12-8-7-11(16)13(14(12)17)15(19)20/h7-8H,3-6,9-10H2,1-2H3,(H,19,20) |
| InChIKey | CSOARELQRYOCOT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |