3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid

C15H21F2NO6S2 — CID 123294885

IUPAC3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid
SMILESCCCCS(=O)(=O)N(c1ccc(F)c(C(=O)O)c1F)S(=O)(=O)CCCC
InChIInChI=1S/C15H21F2NO6S2/c1-3-5-9-25(21,22)18(26(23,24)10-6-4-2)12-8-7-11(16)13(14(12)17)15(19)20/h7-8H,3-6,9-10H2,1-2H3,(H,19,20)
InChIKeyCSOARELQRYOCOT-UHFFFAOYSA-N
MW413.46 g/mol
LogP2.73
Rot. Bonds10

About 3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid

3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid (PubChem CID 123294885) has the molecular formula C15H21F2NO6S2 and a molecular weight of 413.46 g/mol. Its IUPAC name is 3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid.

Molecular Properties

Compound Name3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid
PubChem CID123294885
Molecular FormulaC15H21F2NO6S2
Molecular Weight413.46 g/mol
Exact Mass413.08
IUPAC Name3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid
SMILESCCCCS(=O)(=O)N(c1ccc(F)c(C(=O)O)c1F)S(=O)(=O)CCCC
InChIInChI=1S/C15H21F2NO6S2/c1-3-5-9-25(21,22)18(26(23,24)10-6-4-2)12-8-7-11(16)13(14(12)17)15(19)20/h7-8H,3-6,9-10H2,1-2H3,(H,19,20)
InChIKeyCSOARELQRYOCOT-UHFFFAOYSA-N
XLogP2.73
TPSA108.82 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds10
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500413.46
LogP ≤ 52.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid?
The IUPAC name of 3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid (CID 123294885) is 3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid.
What is the SMILES notation for 3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid?
The canonical SMILES for 3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid is CCCCS(=O)(=O)N(c1ccc(F)c(C(=O)O)c1F)S(=O)(=O)CCCC.
What is the InChIKey of 3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid?
The InChIKey is CSOARELQRYOCOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2NO6S2/c1-3-5-9-25(21,22)18(26(23,24)10-6-4-2)12-8-7-11(16)13(14(12)17)15(19)20/h7-8H,3-6,9-10H2,1-2H3,(H,19,20).
What are the key properties of 3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid?
3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid has a molecular weight of 413.46 g/mol, XLogP of 2.73, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bis(butylsulfonyl)amino]-2,6-difluorobenzoic acid is sourced from PubChem (CID 123294885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).