C21H25F3N2O8S2 — CID 162221178
3-amino-2,6-difluorobenzoic acid;3-[bis(propylsulfonyl)amino]-2-fluoro-6-methylbenzoic acid (PubChem CID 162221178) has the molecular formula C21H25F3N2O8S2 and a molecular weight of 554.57 g/mol. Its IUPAC name is 3-amino-2,6-difluorobenzoic acid;3-[bis(propylsulfonyl)amino]-2-fluoro-6-methylbenzoic acid.
| Compound Name | 3-amino-2,6-difluorobenzoic acid;3-[bis(propylsulfonyl)amino]-2-fluoro-6-methylbenzoic acid |
|---|---|
| PubChem CID | 162221178 |
| Molecular Formula | C21H25F3N2O8S2 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | 3-amino-2,6-difluorobenzoic acid;3-[bis(propylsulfonyl)amino]-2-fluoro-6-methylbenzoic acid |
| SMILES | CCCS(=O)(=O)N(c1ccc(C)c(C(=O)O)c1F)S(=O)(=O)CCC.Nc1ccc(F)c(C(=O)O)c1F |
| InChI | InChI=1S/C14H20FNO6S2.C7H5F2NO2/c1-4-8-23(19,20)16(24(21,22)9-5-2)11-7-6-10(3)12(13(11)15)14(17)18;8-3-1-2-4(10)6(9)5(3)7(11)12/h6-7H,4-5,8-9H2,1-3H3,(H,17,18);1-2H,10H2,(H,11,12) |
| InChIKey | ZUDIPVLFCWNGRL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 172.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|