C18H18ClN3O4S — CID 9156533
N'-[(2R)-2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]-N-prop-2-enyloxamide (PubChem CID 9156533) has the molecular formula C18H18ClN3O4S and a molecular weight of 407.88 g/mol. Its IUPAC name is N'-[(2R)-2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]-N-prop-2-enyloxamide.
| Compound Name | N'-[(2R)-2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 9156533 |
| Molecular Formula | C18H18ClN3O4S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N'-[(2R)-2-(4-chlorophenyl)sulfonyl-2-pyridin-3-ylethyl]-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NC[C@@H](c1cccnc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClN3O4S/c1-2-9-21-17(23)18(24)22-12-16(13-4-3-10-20-11-13)27(25,26)15-7-5-14(19)6-8-15/h2-8,10-11,16H,1,9,12H2,(H,21,23)(H,22,24)/t16-/m0/s1 |
| InChIKey | LVFZNQJAYWOMNF-INIZCTEOSA-N |
| XLogP | 1.67 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|