C12H19FN2 — CID 91565963
1-N-[(1S)-1-(4-fluorophenyl)ethyl]butane-1,2-diamine (PubChem CID 91565963) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-N-[(1S)-1-(4-fluorophenyl)ethyl]butane-1,2-diamine.
| Compound Name | 1-N-[(1S)-1-(4-fluorophenyl)ethyl]butane-1,2-diamine |
|---|---|
| PubChem CID | 91565963 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-N-[(1S)-1-(4-fluorophenyl)ethyl]butane-1,2-diamine |
| SMILES | CCC(N)CN[C@@H](C)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H19FN2/c1-3-12(14)8-15-9(2)10-4-6-11(13)7-5-10/h4-7,9,12,15H,3,8,14H2,1-2H3/t9-,12?/m0/s1 |
| InChIKey | DRRWBJXDYPQJHY-QHGLUPRGSA-N |
| XLogP | 2.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |