C26H29N5O2 — CID 91566130
1-[1-(2-amino-2-methylpropyl)indol-5-yl]-3-(4-anilino-2-methoxyphenyl)urea (PubChem CID 91566130) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 1-[1-(2-amino-2-methylpropyl)indol-5-yl]-3-(4-anilino-2-methoxyphenyl)urea.
| Compound Name | 1-[1-(2-amino-2-methylpropyl)indol-5-yl]-3-(4-anilino-2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 91566130 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 1-[1-(2-amino-2-methylpropyl)indol-5-yl]-3-(4-anilino-2-methoxyphenyl)urea |
| SMILES | COc1cc(Nc2ccccc2)ccc1NC(=O)Nc1ccc2c(ccn2CC(C)(C)N)c1 |
| InChI | InChI=1S/C26H29N5O2/c1-26(2,27)17-31-14-13-18-15-20(10-12-23(18)31)29-25(32)30-22-11-9-21(16-24(22)33-3)28-19-7-5-4-6-8-19/h4-16,28H,17,27H2,1-3H3,(H2,29,30,32) |
| InChIKey | STYOIQNZDREIEQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |