C14H14F2N4O2 — CID 91567635
5-ethyl-7,8-difluoro-1,3-dimethyl-10H-benzo[g]pteridine-2,4-dione (PubChem CID 91567635) has the molecular formula C14H14F2N4O2 and a molecular weight of 308.29 g/mol. Its IUPAC name is 5-ethyl-7,8-difluoro-1,3-dimethyl-10H-benzo[g]pteridine-2,4-dione.
| Compound Name | 5-ethyl-7,8-difluoro-1,3-dimethyl-10H-benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 91567635 |
| Molecular Formula | C14H14F2N4O2 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 5-ethyl-7,8-difluoro-1,3-dimethyl-10H-benzo[g]pteridine-2,4-dione |
| SMILES | CCN1c2cc(F)c(F)cc2Nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H14F2N4O2/c1-4-20-10-6-8(16)7(15)5-9(10)17-12-11(20)13(21)19(3)14(22)18(12)2/h5-6,17H,4H2,1-3H3 |
| InChIKey | YFBGSGNYGMZFPF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |