C18H19NO — CID 91569054
5-benzyl-3-(2-phenylethyl)-2,5-dihydro-1,2-oxazole (PubChem CID 91569054) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 5-benzyl-3-(2-phenylethyl)-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-benzyl-3-(2-phenylethyl)-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 91569054 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 5-benzyl-3-(2-phenylethyl)-2,5-dihydro-1,2-oxazole |
| SMILES | C1=C(CCc2ccccc2)NOC1Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO/c1-3-7-15(8-4-1)11-12-17-14-18(20-19-17)13-16-9-5-2-6-10-16/h1-10,14,18-19H,11-13H2 |
| InChIKey | PFCXRDUDQXRGTK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |