C9H20O3Si — CID 91569808
3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropanal (PubChem CID 91569808) has the molecular formula C9H20O3Si and a molecular weight of 204.34 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropanal.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropanal |
|---|---|
| PubChem CID | 91569808 |
| Molecular Formula | C9H20O3Si |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropanal |
| SMILES | CC(C)(C)[Si](C)(C)OCC(O)C=O |
| InChI | InChI=1S/C9H20O3Si/c1-9(2,3)13(4,5)12-7-8(11)6-10/h6,8,11H,7H2,1-5H3 |
| InChIKey | BYBUDCCLGHBUMI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|