C30H70O6Si4 — CID 162209214
(2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propanal;(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-1-ol (PubChem CID 162209214) has the molecular formula C30H70O6Si4 and a molecular weight of 639.23 g/mol. Its IUPAC name is (2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propanal;(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-1-ol.
| Compound Name | (2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propanal;(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-1-ol |
|---|---|
| PubChem CID | 162209214 |
| Molecular Formula | C30H70O6Si4 |
| Molecular Weight | 639.23 g/mol |
| Exact Mass | 638.42 |
| IUPAC Name | (2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propanal;(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](C=O)O[Si](C)(C)C(C)(C)C.CC(C)(C)[Si](C)(C)OC[C@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H36O3Si2.C15H34O3Si2/c2*1-14(2,3)19(7,8)17-12-13(11-16)18-20(9,10)15(4,5)6/h13,16H,11-12H2,1-10H3;11,13H,12H2,1-10H3/t2*13-/m00/s1 |
| InChIKey | ZSPOQEWDEJSPSW-CHNGVTQJSA-N |
| XLogP | 8.99 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.23 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|