C13H21NO — CID 91569958
1-(3-cyclohexa-1,3-dien-1-yloxypropyl)pyrrolidine (PubChem CID 91569958) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-(3-cyclohexa-1,3-dien-1-yloxypropyl)pyrrolidine.
| Compound Name | 1-(3-cyclohexa-1,3-dien-1-yloxypropyl)pyrrolidine |
|---|---|
| PubChem CID | 91569958 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-(3-cyclohexa-1,3-dien-1-yloxypropyl)pyrrolidine |
| SMILES | C1=CCCC(OCCCN2CCCC2)=C1 |
| InChI | InChI=1S/C13H21NO/c1-2-7-13(8-3-1)15-12-6-11-14-9-4-5-10-14/h1-2,7H,3-6,8-12H2 |
| InChIKey | CPMBKLMJZLOGIJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|