C12H17NO — CID 125460455
1-(2-cyclohexa-1,3,4-trien-1-yloxyethyl)pyrrolidine (PubChem CID 125460455) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 1-(2-cyclohexa-1,3,4-trien-1-yloxyethyl)pyrrolidine.
| Compound Name | 1-(2-cyclohexa-1,3,4-trien-1-yloxyethyl)pyrrolidine |
|---|---|
| PubChem CID | 125460455 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 1-(2-cyclohexa-1,3,4-trien-1-yloxyethyl)pyrrolidine |
| SMILES | C1=CC=C(OCCN2CCCC2)CC=1 |
| InChI | InChI=1S/C12H17NO/c1-2-6-12(7-3-1)14-11-10-13-8-4-5-9-13/h2-3,6H,4-5,7-11H2 |
| InChIKey | QJRXVYGEMCBAKG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |