About 2-cyclohexa-1,3,4-trien-1-yloxy-N,N-diethylethanamine
2-cyclohexa-1,3,4-trien-1-yloxy-N,N-diethylethanamine (PubChem CID 172975734) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-cyclohexa-1,3,4-trien-1-yloxy-N,N-diethylethanamine.
Analyze 2-cyclohexa-1,3,4-trien-1-yloxy-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-1,3,4-trien-1-yloxy-N,N-diethylethanamine?
The IUPAC name of 2-cyclohexa-1,3,4-trien-1-yloxy-N,N-diethylethanamine (CID 172975734) is 2-cyclohexa-1,3,4-trien-1-yloxy-N,N-diethylethanamine.
What is the SMILES notation for 2-cyclohexa-1,3,4-trien-1-yloxy-N,N-diethylethanamine?
The canonical SMILES for 2-cyclohexa-1,3,4-trien-1-yloxy-N,N-diethylethanamine is CCN(CC)CCOC1=CC=C=CC1.
What is the InChIKey of 2-cyclohexa-1,3,4-trien-1-yloxy-N,N-diethylethanamine?
The InChIKey is DCUJBEACHPRGNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-3-13(4-2)10-11-14-12-8-6-5-7-9-12/h6-8H,3-4,9-11H2,1-2H3.
What are the key properties of 2-cyclohexa-1,3,4-trien-1-yloxy-N,N-diethylethanamine?
2-cyclohexa-1,3,4-trien-1-yloxy-N,N-diethylethanamine has a molecular weight of 193.29 g/mol, XLogP of 2.34, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,3,4-trien-1-yloxy-N,N-diethylethanamine is sourced from PubChem (CID 172975734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).