C14H22NO — CID 142057030
CID 142057030 (PubChem CID 142057030) has the molecular formula C14H22NO and a molecular weight of 220.34 g/mol.
| Compound Name | CID 142057030 |
|---|---|
| PubChem CID | 142057030 |
| Molecular Formula | C14H22NO |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | — |
| SMILES | [CH2]/C(=C\C=C(\C)C=C)OCCN1CCCC1 |
| InChI | InChI=1S/C14H22NO/c1-4-13(2)7-8-14(3)16-12-11-15-9-5-6-10-15/h4,7-8H,1,3,5-6,9-12H2,2H3/b13-7-,14-8+ |
| InChIKey | HOAJUCLSIPKDSR-MFUUIURDSA-N |
| XLogP | 2.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|