About 1,3,6-trimethyl-5-(nitrosomethyl)pyrimidine-2,4-dione
1,3,6-trimethyl-5-(nitrosomethyl)pyrimidine-2,4-dione (PubChem CID 91571964) has the molecular formula C8H11N3O3
and a molecular weight of 197.19 g/mol. Its IUPAC name is 1,3,6-trimethyl-5-(nitrosomethyl)pyrimidine-2,4-dione.
Analyze 1,3,6-trimethyl-5-(nitrosomethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,6-trimethyl-5-(nitrosomethyl)pyrimidine-2,4-dione?
The IUPAC name of 1,3,6-trimethyl-5-(nitrosomethyl)pyrimidine-2,4-dione (CID 91571964) is 1,3,6-trimethyl-5-(nitrosomethyl)pyrimidine-2,4-dione.
What is the SMILES notation for 1,3,6-trimethyl-5-(nitrosomethyl)pyrimidine-2,4-dione?
The canonical SMILES for 1,3,6-trimethyl-5-(nitrosomethyl)pyrimidine-2,4-dione is Cc1c(CN=O)c(=O)n(C)c(=O)n1C.
What is the InChIKey of 1,3,6-trimethyl-5-(nitrosomethyl)pyrimidine-2,4-dione?
The InChIKey is GKSHCPVZJSQSMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3/c1-5-6(4-9-14)7(12)11(3)8(13)10(5)2/h4H2,1-3H3.
What are the key properties of 1,3,6-trimethyl-5-(nitrosomethyl)pyrimidine-2,4-dione?
1,3,6-trimethyl-5-(nitrosomethyl)pyrimidine-2,4-dione has a molecular weight of 197.19 g/mol, XLogP of -0.34, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,6-trimethyl-5-(nitrosomethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 91571964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).