C29H34O9 — CID 91573343
[(1S,2S,6R,10S,11R,13R,14R,15R)-1,6,14-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 91573343) has the molecular formula C29H34O9 and a molecular weight of 526.58 g/mol. Its IUPAC name is [(1S,2S,6R,10S,11R,13R,14R,15R)-1,6,14-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(1S,2S,6R,10S,11R,13R,14R,15R)-1,6,14-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 91573343 |
| Molecular Formula | C29H34O9 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | [(1S,2S,6R,10S,11R,13R,14R,15R)-1,6,14-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CC1=C[C@H]2[C@@]3(O)[C@H](C)[C@@H](O)[C@@]4(OC(=O)C=Cc5ccc(O)c(O)c5)[C@H]([C@@H]3C=C(CO)C[C@]2(O)C1=O)C4(C)C |
| InChI | InChI=1S/C29H34O9/c1-14-9-21-27(36,24(14)34)12-17(13-30)10-18-23-26(3,4)29(23,25(35)15(2)28(18,21)37)38-22(33)8-6-16-5-7-19(31)20(32)11-16/h5-11,15,18,21,23,25,30-32,35-37H,12-13H2,1-4H3/t15-,18+,21-,23-,25-,27-,28-,29+/m1/s1 |
| InChIKey | XSVBEMPAEONBHD-CMDHRCJISA-N |
| XLogP | 1.61 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|