C10H21F5O5S — CID 91573430
fluoromethane;fluorooxymethanesulfonic acid;1-(3,3,3-trifluoropropoxy)pentane (PubChem CID 91573430) has the molecular formula C10H21F5O5S and a molecular weight of 348.33 g/mol. Its IUPAC name is fluoromethane;fluorooxymethanesulfonic acid;1-(3,3,3-trifluoropropoxy)pentane.
| Compound Name | fluoromethane;fluorooxymethanesulfonic acid;1-(3,3,3-trifluoropropoxy)pentane |
|---|---|
| PubChem CID | 91573430 |
| Molecular Formula | C10H21F5O5S |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | fluoromethane;fluorooxymethanesulfonic acid;1-(3,3,3-trifluoropropoxy)pentane |
| SMILES | CCCCCOCCC(F)(F)F.CF.O=S(=O)(O)COF |
| InChI | InChI=1S/C8H15F3O.CH3FO4S.CH3F/c1-2-3-4-6-12-7-5-8(9,10)11;2-6-1-7(3,4)5;1-2/h2-7H2,1H3;1H2,(H,3,4,5);1H3 |
| InChIKey | DGDPNSXKIGFUGS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|